C14H11N5O2 — CID 79960157
2-[(5-amino-1,3-benzoxazol-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 79960157) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-[(5-amino-1,3-benzoxazol-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 79960157 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[(5-amino-1,3-benzoxazol-2-yl)methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | Nc1ccc2oc(Cn3nc4ccccn4c3=O)nc2c1 |
| InChI | InChI=1S/C14H11N5O2/c15-9-4-5-11-10(7-9)16-13(21-11)8-19-14(20)18-6-2-1-3-12(18)17-19/h1-7H,8,15H2 |
| InChIKey | RLBCZRDGWAKORA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|