C13H11BrN4O2 — CID 79972147
3-[(5-amino-1,3-benzoxazol-2-yl)methyl]-5-bromo-6-methylpyrimidin-4-one (PubChem CID 79972147) has the molecular formula C13H11BrN4O2 and a molecular weight of 335.16 g/mol. Its IUPAC name is 3-[(5-amino-1,3-benzoxazol-2-yl)methyl]-5-bromo-6-methylpyrimidin-4-one.
| Compound Name | 3-[(5-amino-1,3-benzoxazol-2-yl)methyl]-5-bromo-6-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 79972147 |
| Molecular Formula | C13H11BrN4O2 |
| Molecular Weight | 335.16 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 3-[(5-amino-1,3-benzoxazol-2-yl)methyl]-5-bromo-6-methylpyrimidin-4-one |
| SMILES | Cc1ncn(Cc2nc3cc(N)ccc3o2)c(=O)c1Br |
| InChI | InChI=1S/C13H11BrN4O2/c1-7-12(14)13(19)18(6-16-7)5-11-17-9-4-8(15)2-3-10(9)20-11/h2-4,6H,5,15H2,1H3 |
| InChIKey | ZVGNERCASJJYQB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.16 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|