C12H10N4O3 — CID 79964658
1-[(5-amino-1,3-benzoxazol-2-yl)methyl]pyrimidine-2,4-dione (PubChem CID 79964658) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 1-[(5-amino-1,3-benzoxazol-2-yl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(5-amino-1,3-benzoxazol-2-yl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79964658 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[(5-amino-1,3-benzoxazol-2-yl)methyl]pyrimidine-2,4-dione |
| SMILES | Nc1ccc2oc(Cn3ccc(=O)[nH]c3=O)nc2c1 |
| InChI | InChI=1S/C12H10N4O3/c13-7-1-2-9-8(5-7)14-11(19-9)6-16-4-3-10(17)15-12(16)18/h1-5H,6,13H2,(H,15,17,18) |
| InChIKey | FPWXQCGKSXMWQQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|