C21H19FN4O2S — CID 100694748
N-(2-fluorophenyl)-3-[(4R,5R)-5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide (PubChem CID 100694748) has the molecular formula C21H19FN4O2S and a molecular weight of 410.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[(4R,5R)-5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[(4R,5R)-5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100694748 |
| Molecular Formula | C21H19FN4O2S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-[(4R,5R)-5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]propanamide |
| SMILES | O=C(CCN1C(=S)N[C@@H](c2ccccn2)[C@@H]1c1ccco1)Nc1ccccc1F |
| InChI | InChI=1S/C21H19FN4O2S/c22-14-6-1-2-7-15(14)24-18(27)10-12-26-20(17-9-5-13-28-17)19(25-21(26)29)16-8-3-4-11-23-16/h1-9,11,13,19-20H,10,12H2,(H,24,27)(H,25,29)/t19-,20-/m0/s1 |
| InChIKey | JMNZXZRZFRJIPF-PMACEKPBSA-N |
| XLogP | 3.82 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|