C22H22N4O2S — CID 133218490
3-[5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide (PubChem CID 133218490) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-[5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide.
| Compound Name | 3-[5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 133218490 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[5-(furan-2-yl)-4-pyridin-2-yl-2-sulfanylideneimidazolidin-1-yl]-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCN2C(=S)NC(c3ccccn3)C2c2ccco2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-15-7-9-16(10-8-15)24-19(27)11-13-26-21(18-6-4-14-28-18)20(25-22(26)29)17-5-2-3-12-23-17/h2-10,12,14,20-21H,11,13H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | WXVOYHCMSAGXKS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|