C16H24ClNO3 — CID 100696673
(2S)-N-(3-chloro-4-ethoxyphenyl)-2-methoxy-2,4-dimethylpentanamide (PubChem CID 100696673) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is (2S)-N-(3-chloro-4-ethoxyphenyl)-2-methoxy-2,4-dimethylpentanamide.
| Compound Name | (2S)-N-(3-chloro-4-ethoxyphenyl)-2-methoxy-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 100696673 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2S)-N-(3-chloro-4-ethoxyphenyl)-2-methoxy-2,4-dimethylpentanamide |
| SMILES | CCOc1ccc(NC(=O)[C@](C)(CC(C)C)OC)cc1Cl |
| InChI | InChI=1S/C16H24ClNO3/c1-6-21-14-8-7-12(9-13(14)17)18-15(19)16(4,20-5)10-11(2)3/h7-9,11H,6,10H2,1-5H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | WTLPPPGIQBCDED-INIZCTEOSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |