C19H30ClNO3 — CID 100699464
N-(3-chloro-4-ethoxyphenyl)-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide (PubChem CID 100699464) has the molecular formula C19H30ClNO3 and a molecular weight of 355.91 g/mol. Its IUPAC name is N-(3-chloro-4-ethoxyphenyl)-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide.
| Compound Name | N-(3-chloro-4-ethoxyphenyl)-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 100699464 |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(3-chloro-4-ethoxyphenyl)-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide |
| SMILES | CCOc1ccc(NC(=O)C(CC(C)C)(CC(C)C)OC)cc1Cl |
| InChI | InChI=1S/C19H30ClNO3/c1-7-24-17-9-8-15(10-16(17)20)21-18(22)19(23-6,11-13(2)3)12-14(4)5/h8-10,13-14H,7,11-12H2,1-6H3,(H,21,22) |
| InChIKey | TZRVDIKYSAXKSO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |