C24H25ClN2O2 — CID 100696835
N-[(S)-(4-chlorophenyl)-cyclopentylmethyl]-N-methyl-2-(2-oxo-1H-quinolin-3-yl)acetamide (PubChem CID 100696835) has the molecular formula C24H25ClN2O2 and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[(S)-(4-chlorophenyl)-cyclopentylmethyl]-N-methyl-2-(2-oxo-1H-quinolin-3-yl)acetamide.
| Compound Name | N-[(S)-(4-chlorophenyl)-cyclopentylmethyl]-N-methyl-2-(2-oxo-1H-quinolin-3-yl)acetamide |
|---|---|
| PubChem CID | 100696835 |
| Molecular Formula | C24H25ClN2O2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(S)-(4-chlorophenyl)-cyclopentylmethyl]-N-methyl-2-(2-oxo-1H-quinolin-3-yl)acetamide |
| SMILES | CN(C(=O)Cc1cc2ccccc2[nH]c1=O)[C@H](c1ccc(Cl)cc1)C1CCCC1 |
| InChI | InChI=1S/C24H25ClN2O2/c1-27(23(16-6-2-3-7-16)17-10-12-20(25)13-11-17)22(28)15-19-14-18-8-4-5-9-21(18)26-24(19)29/h4-5,8-14,16,23H,2-3,6-7,15H2,1H3,(H,26,29)/t23-/m0/s1 |
| InChIKey | IJVRFGBKAAPZRO-QHCPKHFHSA-N |
| XLogP | 5.11 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |