C20H25NO3 — CID 100696968
(2S)-2-methoxy-2-methyl-N-(4-phenylmethoxyphenyl)pentanamide (PubChem CID 100696968) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S)-2-methoxy-2-methyl-N-(4-phenylmethoxyphenyl)pentanamide.
| Compound Name | (2S)-2-methoxy-2-methyl-N-(4-phenylmethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 100696968 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2S)-2-methoxy-2-methyl-N-(4-phenylmethoxyphenyl)pentanamide |
| SMILES | CCC[C@](C)(OC)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-4-14-20(2,23-3)19(22)21-17-10-12-18(13-11-17)24-15-16-8-6-5-7-9-16/h5-13H,4,14-15H2,1-3H3,(H,21,22)/t20-/m0/s1 |
| InChIKey | JBVCHYTWWWWVAK-FQEVSTJZSA-N |
| XLogP | 4.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |