C25H29NO6S — CID 100699051
(1R,2R,3R,4R)-3-[[4-(4-butylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 100699051) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[[4-(4-butylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[[4-(4-butylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 100699051 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (1R,2R,3R,4R)-3-[[4-(4-butylphenyl)-3-ethoxycarbonylthiophen-2-yl]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCCCc1ccc(-c2csc(NC(=O)[C@@H]3[C@@H](C(=O)O)[C@H]4CC[C@H]3O4)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H29NO6S/c1-3-5-6-14-7-9-15(10-8-14)16-13-33-23(19(16)25(30)31-4-2)26-22(27)20-17-11-12-18(32-17)21(20)24(28)29/h7-10,13,17-18,20-21H,3-6,11-12H2,1-2H3,(H,26,27)(H,28,29)/t17-,18-,20+,21+/m1/s1 |
| InChIKey | CXNJPTWSJVTPCZ-QCFAMHMHSA-N |
| XLogP | 4.75 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|