C24H31N3O3 — CID 10070099
(E)-3-(furan-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-[(2-phenylacetyl)amino]prop-2-enamide (PubChem CID 10070099) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-[(2-phenylacetyl)amino]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-[(2-phenylacetyl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 10070099 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[3-(2-methylpiperidin-1-yl)propyl]-2-[(2-phenylacetyl)amino]prop-2-enamide |
| SMILES | CC1CCCCN1CCCNC(=O)/C(=C\c1ccco1)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O3/c1-19-9-5-6-14-27(19)15-8-13-25-24(29)22(18-21-12-7-16-30-21)26-23(28)17-20-10-3-2-4-11-20/h2-4,7,10-12,16,18-19H,5-6,8-9,13-15,17H2,1H3,(H,25,29)(H,26,28)/b22-18+ |
| InChIKey | VPHPMWJXAATLRG-RELWKKBWSA-N |
| XLogP | 3.36 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|