C30H34Cl3N3O5S — CID 100701296
(2R)-N-butyl-2-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100701296) has the molecular formula C30H34Cl3N3O5S and a molecular weight of 655.04 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100701296 |
| Molecular Formula | C30H34Cl3N3O5S |
| Molecular Weight | 655.04 g/mol |
| Exact Mass | 653.13 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]-[(2,6-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc(OC)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C30H34Cl3N3O5S/c1-4-5-16-34-30(38)27(17-21-10-7-6-8-11-21)35(19-23-24(31)12-9-13-25(23)32)29(37)20-36(42(3,39)40)22-14-15-28(41-2)26(33)18-22/h6-15,18,27H,4-5,16-17,19-20H2,1-3H3,(H,34,38)/t27-/m1/s1 |
| InChIKey | PIZYKBGUWKYRIM-HHHXNRCGSA-N |
| XLogP | 5.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.04 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|