C30H35BrClN3O5S — CID 133206112
2-[(3-bromophenyl)methyl-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 133206112) has the molecular formula C30H35BrClN3O5S and a molecular weight of 665.05 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | 2-[(3-bromophenyl)methyl-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 133206112 |
| Molecular Formula | C30H35BrClN3O5S |
| Molecular Weight | 665.05 g/mol |
| Exact Mass | 663.12 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-[2-(3-chloro-4-methoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)C(Cc1ccccc1)N(Cc1cccc(Br)c1)C(=O)CN(c1ccc(OC)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C30H35BrClN3O5S/c1-4-5-16-33-30(37)27(18-22-10-7-6-8-11-22)34(20-23-12-9-13-24(31)17-23)29(36)21-35(41(3,38)39)25-14-15-28(40-2)26(32)19-25/h6-15,17,19,27H,4-5,16,18,20-21H2,1-3H3,(H,33,37) |
| InChIKey | RSBHTNQLOFCRME-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.05 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|