C31H38BrN3O6S — CID 100674825
(2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100674825) has the molecular formula C31H38BrN3O6S and a molecular weight of 660.63 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100674825 |
| Molecular Formula | C31H38BrN3O6S |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 659.17 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc(OC)c(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C31H38BrN3O6S/c1-5-6-18-33-31(37)27(19-23-10-8-7-9-11-23)34(21-24-12-14-25(32)15-13-24)30(36)22-35(42(4,38)39)26-16-17-28(40-2)29(20-26)41-3/h7-17,20,27H,5-6,18-19,21-22H2,1-4H3,(H,33,37)/t27-/m1/s1 |
| InChIKey | FOJRCQPTVRVDOL-HHHXNRCGSA-N |
| XLogP | 4.79 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|