C37H42BrN3O6S — CID 100673929
(2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide (PubChem CID 100673929) has the molecular formula C37H42BrN3O6S and a molecular weight of 736.73 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100673929 |
| Molecular Formula | C37H42BrN3O6S |
| Molecular Weight | 736.73 g/mol |
| Exact Mass | 735.20 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-N-butyl-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Br)cc1)C(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H42BrN3O6S/c1-5-6-22-39-37(43)33(23-28-10-8-7-9-11-28)40(25-29-14-16-30(38)17-15-29)36(42)26-41(31-18-21-34(46-3)35(24-31)47-4)48(44,45)32-19-12-27(2)13-20-32/h7-21,24,33H,5-6,22-23,25-26H2,1-4H3,(H,39,43)/t33-/m1/s1 |
| InChIKey | DYMYIJZZQYUTOD-MGBGTMOVSA-N |
| XLogP | 6.53 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|