C37H41Cl2N3O6S — CID 100700101
(2R)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100700101) has the molecular formula C37H41Cl2N3O6S and a molecular weight of 726.72 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100700101 |
| Molecular Formula | C37H41Cl2N3O6S |
| Molecular Weight | 726.72 g/mol |
| Exact Mass | 725.21 |
| IUPAC Name | (2R)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1ccc(OC)c(OC)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C37H41Cl2N3O6S/c1-5-6-21-40-37(44)33(22-27-11-8-7-9-12-27)41(24-30-31(38)13-10-14-32(30)39)36(43)25-42(28-17-20-34(47-3)35(23-28)48-4)49(45,46)29-18-15-26(2)16-19-29/h7-20,23,33H,5-6,21-22,24-25H2,1-4H3,(H,40,44)/t33-/m1/s1 |
| InChIKey | CTBLVDKFUXDIRC-MGBGTMOVSA-N |
| XLogP | 7.07 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.72 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|