C22H25NO3SSi — CID 10070224
(2R,3R)-3-(benzenesulfonyl)-9-methyl-2-trimethylsilyl-2,3-dihydro-1H-carbazol-4-one (PubChem CID 10070224) has the molecular formula C22H25NO3SSi and a molecular weight of 411.60 g/mol. Its IUPAC name is (2R,3R)-3-(benzenesulfonyl)-9-methyl-2-trimethylsilyl-2,3-dihydro-1H-carbazol-4-one.
| Compound Name | (2R,3R)-3-(benzenesulfonyl)-9-methyl-2-trimethylsilyl-2,3-dihydro-1H-carbazol-4-one |
|---|---|
| PubChem CID | 10070224 |
| Molecular Formula | C22H25NO3SSi |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2R,3R)-3-(benzenesulfonyl)-9-methyl-2-trimethylsilyl-2,3-dihydro-1H-carbazol-4-one |
| SMILES | Cn1c2c(c3ccccc31)C(=O)[C@@H](S(=O)(=O)c1ccccc1)[C@H]([Si](C)(C)C)C2 |
| InChI | InChI=1S/C22H25NO3SSi/c1-23-17-13-9-8-12-16(17)20-18(23)14-19(28(2,3)4)22(21(20)24)27(25,26)15-10-6-5-7-11-15/h5-13,19,22H,14H2,1-4H3/t19-,22+/m1/s1 |
| InChIKey | COQWFHUQERPXKV-KNQAVFIVSA-N |
| XLogP | 4.47 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|