C22H20N2 — CID 102058604
(1S,12S)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene (PubChem CID 102058604) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (1S,12S)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene.
| Compound Name | (1S,12S)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene |
|---|---|
| PubChem CID | 102058604 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (1S,12S)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene |
| SMILES | Cn1c2c(c3ccccc31)[C@H]1Cc3c(c4ccccc4n3C)[C@H]1C2 |
| InChI | InChI=1S/C22H20N2/c1-23-17-9-5-3-7-13(17)21-16-12-20-22(15(16)11-19(21)23)14-8-4-6-10-18(14)24(20)2/h3-10,15-16H,11-12H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | RXFDXVFLWVVRNA-HOTGVXAUSA-N |
| XLogP | 4.65 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|