C22H20N2O2 — CID 102058607
(1S,11R,12S,22R)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene-11,22-diol (PubChem CID 102058607) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is (1S,11R,12S,22R)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene-11,22-diol.
| Compound Name | (1S,11R,12S,22R)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene-11,22-diol |
|---|---|
| PubChem CID | 102058607 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (1S,11R,12S,22R)-9,20-dimethyl-9,20-diazahexacyclo[10.10.0.02,10.03,8.013,21.014,19]docosa-2(10),3,5,7,13(21),14,16,18-octaene-11,22-diol |
| SMILES | Cn1c2c(c3ccccc31)[C@@H]1[C@@H](c3c(n(C)c4ccccc34)[C@@H]1O)[C@H]2O |
| InChI | InChI=1S/C22H20N2O2/c1-23-13-9-5-3-7-11(13)15-17-18(21(25)19(15)23)16-12-8-4-6-10-14(12)24(2)20(16)22(17)26/h3-10,17-18,21-22,25-26H,1-2H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | JJEJEVHJIPPLBG-MCEIDBOGSA-N |
| XLogP | 3.63 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |