C14H17N2+ — CID 162037381
1,2,3,4-tetramethyl-3H-pyrrolo[3,2-b]indol-1-ium (PubChem CID 162037381) has the molecular formula C14H17N2+ and a molecular weight of 213.30 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-3H-pyrrolo[3,2-b]indol-1-ium.
| Compound Name | 1,2,3,4-tetramethyl-3H-pyrrolo[3,2-b]indol-1-ium |
|---|---|
| PubChem CID | 162037381 |
| Molecular Formula | C14H17N2+ |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1,2,3,4-tetramethyl-3H-pyrrolo[3,2-b]indol-1-ium |
| SMILES | CC1=[N+](C)c2c(n(C)c3ccccc23)C1C |
| InChI | InChI=1S/C14H17N2/c1-9-10(2)15(3)14-11-7-5-6-8-12(11)16(4)13(9)14/h5-9H,1-4H3/q+1 |
| InChIKey | LBESBBVRYCWYIX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|