C21H35NO3 — CID 100702377
(2R)-N-(4-butoxy-3,5-dimethylphenyl)-2-methoxy-2-methylheptanamide (PubChem CID 100702377) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (2R)-N-(4-butoxy-3,5-dimethylphenyl)-2-methoxy-2-methylheptanamide.
| Compound Name | (2R)-N-(4-butoxy-3,5-dimethylphenyl)-2-methoxy-2-methylheptanamide |
|---|---|
| PubChem CID | 100702377 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (2R)-N-(4-butoxy-3,5-dimethylphenyl)-2-methoxy-2-methylheptanamide |
| SMILES | CCCCC[C@@](C)(OC)C(=O)Nc1cc(C)c(OCCCC)c(C)c1 |
| InChI | InChI=1S/C21H35NO3/c1-7-9-11-12-21(5,24-6)20(23)22-18-14-16(3)19(17(4)15-18)25-13-10-8-2/h14-15H,7-13H2,1-6H3,(H,22,23)/t21-/m1/s1 |
| InChIKey | AGQDLZALCKMHMW-OAQYLSRUSA-N |
| XLogP | 5.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|