C19H31NO3 — CID 133246537
N-(4-butoxy-3,5-dimethylphenyl)-2-ethoxy-2-methylbutanamide (PubChem CID 133246537) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is N-(4-butoxy-3,5-dimethylphenyl)-2-ethoxy-2-methylbutanamide.
| Compound Name | N-(4-butoxy-3,5-dimethylphenyl)-2-ethoxy-2-methylbutanamide |
|---|---|
| PubChem CID | 133246537 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | N-(4-butoxy-3,5-dimethylphenyl)-2-ethoxy-2-methylbutanamide |
| SMILES | CCCCOc1c(C)cc(NC(=O)C(C)(CC)OCC)cc1C |
| InChI | InChI=1S/C19H31NO3/c1-7-10-11-22-17-14(4)12-16(13-15(17)5)20-18(21)19(6,8-2)23-9-3/h12-13H,7-11H2,1-6H3,(H,20,21) |
| InChIKey | MRQITKQTNGXSMY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|