C18H19N3O3S — CID 100702588
2-cyano-N-[(R)-oxan-4-yl(pyridin-3-yl)methyl]benzenesulfonamide (PubChem CID 100702588) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 2-cyano-N-[(R)-oxan-4-yl(pyridin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 2-cyano-N-[(R)-oxan-4-yl(pyridin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 100702588 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-cyano-N-[(R)-oxan-4-yl(pyridin-3-yl)methyl]benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N[C@@H](c1cccnc1)C1CCOCC1 |
| InChI | InChI=1S/C18H19N3O3S/c19-12-15-4-1-2-6-17(15)25(22,23)21-18(14-7-10-24-11-8-14)16-5-3-9-20-13-16/h1-6,9,13-14,18,21H,7-8,10-11H2/t18-/m1/s1 |
| InChIKey | KSWPOAYJRZBPRE-GOSISDBHSA-N |
| XLogP | 2.40 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |