C16H24N2O3S — CID 128502716
N-[cyclopropyl(pyridin-3-yl)methyl]-2-(oxan-4-yl)ethanesulfonamide (PubChem CID 128502716) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[cyclopropyl(pyridin-3-yl)methyl]-2-(oxan-4-yl)ethanesulfonamide.
| Compound Name | N-[cyclopropyl(pyridin-3-yl)methyl]-2-(oxan-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 128502716 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[cyclopropyl(pyridin-3-yl)methyl]-2-(oxan-4-yl)ethanesulfonamide |
| SMILES | O=S(=O)(CCC1CCOCC1)NC(c1cccnc1)C1CC1 |
| InChI | InChI=1S/C16H24N2O3S/c19-22(20,11-7-13-5-9-21-10-6-13)18-16(14-3-4-14)15-2-1-8-17-12-15/h1-2,8,12-14,16,18H,3-7,9-11H2 |
| InChIKey | FPVCSHIWIRRTQF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |