C17H28N2O3 — CID 100703789
N-[(2S)-4-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-4-oxobutan-2-yl]cyclopentanecarboxamide (PubChem CID 100703789) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is N-[(2S)-4-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-4-oxobutan-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[(2S)-4-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-4-oxobutan-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 100703789 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-[(2S)-4-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-4-oxobutan-2-yl]cyclopentanecarboxamide |
| SMILES | C[C@@H](CC(=O)N1CC[C@H]2OCC[C@H]2C1)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C17H28N2O3/c1-12(18-17(21)13-4-2-3-5-13)10-16(20)19-8-6-15-14(11-19)7-9-22-15/h12-15H,2-11H2,1H3,(H,18,21)/t12-,14-,15+/m0/s1 |
| InChIKey | QNTVHPSKQROFQD-AEGPPILISA-N |
| XLogP | 1.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |