C9H15NO3 — CID 130671896
1-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-hydroxyethanone (PubChem CID 130671896) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-hydroxyethanone.
| Compound Name | 1-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 130671896 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 1-[(3aS,7aR)-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CC[C@H]2OCC[C@H]2C1 |
| InChI | InChI=1S/C9H15NO3/c11-6-9(12)10-3-1-8-7(5-10)2-4-13-8/h7-8,11H,1-6H2/t7-,8+/m0/s1 |
| InChIKey | KOEXRGPZXJDUGP-JGVFFNPUSA-N |
| XLogP | -0.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |