C9H14N2O3 — CID 164729670
(4aS,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxamide (PubChem CID 164729670) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is (4aS,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxamide.
| Compound Name | (4aS,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 164729670 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | (4aS,8aS)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxamide |
| SMILES | NC(=O)N1CC[C@@H]2OCC(=O)C[C@H]2C1 |
| InChI | InChI=1S/C9H14N2O3/c10-9(13)11-2-1-8-6(4-11)3-7(12)5-14-8/h6,8H,1-5H2,(H2,10,13)/t6-,8-/m0/s1 |
| InChIKey | GKXGNZREXCDRRD-XPUUQOCRSA-N |
| XLogP | -0.25 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |