C15H16N2O6 — CID 158325102
(4-nitrophenyl) (4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxylate (PubChem CID 158325102) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is (4-nitrophenyl) (4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxylate.
| Compound Name | (4-nitrophenyl) (4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 158325102 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (4-nitrophenyl) (4aS,8aR)-3-oxo-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridine-6-carboxylate |
| SMILES | O=C1CO[C@@H]2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H16N2O6/c18-12-7-10-8-16(6-5-14(10)22-9-12)15(19)23-13-3-1-11(2-4-13)17(20)21/h1-4,10,14H,5-9H2/t10-,14+/m0/s1 |
| InChIKey | MVDLSEBMTPFNCO-IINYFYTJSA-N |
| XLogP | 1.77 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|