C18H19N3O5 — CID 166162737
(4-nitrophenyl) 3-(1-methyl-2-oxo-3-pyridinyl)piperidine-1-carboxylate (PubChem CID 166162737) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is (4-nitrophenyl) 3-(1-methyl-2-oxo-3-pyridinyl)piperidine-1-carboxylate.
| Compound Name | (4-nitrophenyl) 3-(1-methyl-2-oxo-3-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166162737 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (4-nitrophenyl) 3-(1-methyl-2-oxo-3-pyridinyl)piperidine-1-carboxylate |
| SMILES | Cn1cccc(C2CCCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)C2)c1=O |
| InChI | InChI=1S/C18H19N3O5/c1-19-10-3-5-16(17(19)22)13-4-2-11-20(12-13)18(23)26-15-8-6-14(7-9-15)21(24)25/h3,5-10,13H,2,4,11-12H2,1H3 |
| InChIKey | VENFXCLWPBIIPB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|