C11H19NO — CID 98815743
(3aS,7aR)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 98815743) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3aS,7aR)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (3aS,7aR)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 98815743 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3aS,7aR)-5-cyclobutyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | C1CC(N2CC[C@H]3OCC[C@H]3C2)C1 |
| InChI | InChI=1S/C11H19NO/c1-2-10(3-1)12-6-4-11-9(8-12)5-7-13-11/h9-11H,1-8H2/t9-,11+/m0/s1 |
| InChIKey | RVWYDDTVTTUIIO-GXSJLCMTSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |