C14H24N2O3S — CID 97474061
(5aR,8aS)-7-cyclobutyl-4-cyclopropylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 97474061) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is (5aR,8aS)-7-cyclobutyl-4-cyclopropylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aR,8aS)-7-cyclobutyl-4-cyclopropylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97474061 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | (5aR,8aS)-7-cyclobutyl-4-cyclopropylsulfonyl-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | O=S(=O)(C1CC1)N1CCO[C@@H]2CN(C3CCC3)C[C@@H]2C1 |
| InChI | InChI=1S/C14H24N2O3S/c17-20(18,13-4-5-13)16-6-7-19-14-10-15(8-11(14)9-16)12-2-1-3-12/h11-14H,1-10H2/t11-,14-/m1/s1 |
| InChIKey | YSDHHFRFLUIRGF-BXUZGUMPSA-N |
| XLogP | 0.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |