C19H28N2O2 — CID 100705765
(3aR,7aR)-N-[2-(2-methylpropoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 100705765) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is (3aR,7aR)-N-[2-(2-methylpropoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3aR,7aR)-N-[2-(2-methylpropoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 100705765 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (3aR,7aR)-N-[2-(2-methylpropoxy)phenyl]-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | CC(C)COc1ccccc1NC(=O)N1CC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H28N2O2/c1-14(2)13-23-18-10-6-4-8-16(18)20-19(22)21-12-11-15-7-3-5-9-17(15)21/h4,6,8,10,14-15,17H,3,5,7,9,11-13H2,1-2H3,(H,20,22)/t15-,17-/m1/s1 |
| InChIKey | WWTZMMZYXMCSBJ-NVXWUHKLSA-N |
| XLogP | 4.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |