C23H28N2O3 — CID 52501869
(4aR,8aR)-N-[2-(2-phenylethoxy)phenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide (PubChem CID 52501869) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is (4aR,8aR)-N-[2-(2-phenylethoxy)phenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide.
| Compound Name | (4aR,8aR)-N-[2-(2-phenylethoxy)phenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 52501869 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (4aR,8aR)-N-[2-(2-phenylethoxy)phenyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1OCCc1ccccc1)N1CCO[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H28N2O3/c26-23(25-15-17-28-22-13-7-5-11-20(22)25)24-19-10-4-6-12-21(19)27-16-14-18-8-2-1-3-9-18/h1-4,6,8-10,12,20,22H,5,7,11,13-17H2,(H,24,26)/t20-,22-/m1/s1 |
| InChIKey | UUVWLXQQNDRRTH-IFMALSPDSA-N |
| XLogP | 4.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |