C17H23ClN2O3 — CID 47049665
N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide (PubChem CID 47049665) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 47049665 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine-4-carboxamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11-9-13(16(22-2)10-12(11)18)19-17(21)20-7-8-23-15-6-4-3-5-14(15)20/h9-10,14-15H,3-8H2,1-2H3,(H,19,21) |
| InChIKey | GAUNQCIKKNWFKN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |