C21H26N2O4 — CID 118761290
(3S,4S)-3,4-dihydroxy-N-[2-(3-phenylpropoxy)phenyl]piperidine-1-carboxamide (PubChem CID 118761290) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-N-[2-(3-phenylpropoxy)phenyl]piperidine-1-carboxamide.
| Compound Name | (3S,4S)-3,4-dihydroxy-N-[2-(3-phenylpropoxy)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 118761290 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-N-[2-(3-phenylpropoxy)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1OCCCc1ccccc1)N1CC[C@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C21H26N2O4/c24-18-12-13-23(15-19(18)25)21(26)22-17-10-4-5-11-20(17)27-14-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-11,18-19,24-25H,6,9,12-15H2,(H,22,26)/t18-,19-/m0/s1 |
| InChIKey | XRAUFGYPYSCMSO-OALUTQOASA-N |
| XLogP | 2.66 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|