C15H21N3O2S2 — CID 100706985
4-methyl-3-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole (PubChem CID 100706985) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is 4-methyl-3-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 4-methyl-3-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 100706985 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-methyl-3-[2-[(2S)-oxan-2-yl]oxyethylsulfanyl]-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
| SMILES | Cn1c(Cc2cccs2)nnc1SCCO[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-18-13(11-12-5-4-9-21-12)16-17-15(18)22-10-8-20-14-6-2-3-7-19-14/h4-5,9,14H,2-3,6-8,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | HAGLUNUPQMSXSW-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|