C18H27N3OS2 — CID 78762699
4-cyclohexyl-3-(2-propan-2-yloxyethylsulfanyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole (PubChem CID 78762699) has the molecular formula C18H27N3OS2 and a molecular weight of 365.57 g/mol. Its IUPAC name is 4-cyclohexyl-3-(2-propan-2-yloxyethylsulfanyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole.
| Compound Name | 4-cyclohexyl-3-(2-propan-2-yloxyethylsulfanyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 78762699 |
| Molecular Formula | C18H27N3OS2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-cyclohexyl-3-(2-propan-2-yloxyethylsulfanyl)-5-(thiophen-2-ylmethyl)-1,2,4-triazole |
| SMILES | CC(C)OCCSc1nnc(Cc2cccs2)n1C1CCCCC1 |
| InChI | InChI=1S/C18H27N3OS2/c1-14(2)22-10-12-24-18-20-19-17(13-16-9-6-11-23-16)21(18)15-7-4-3-5-8-15/h6,9,11,14-15H,3-5,7-8,10,12-13H2,1-2H3 |
| InChIKey | LRESHQTXTYYGFC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|