C15H19N5O3S2 — CID 71876032
3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl N-carbamoylcarbamate (PubChem CID 71876032) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl N-carbamoylcarbamate.
| Compound Name | 3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl N-carbamoylcarbamate |
|---|---|
| PubChem CID | 71876032 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]propyl N-carbamoylcarbamate |
| SMILES | NC(=O)NC(=O)OCCCSc1nnc(Cc2cccs2)n1C1CC1 |
| InChI | InChI=1S/C15H19N5O3S2/c16-13(21)17-15(22)23-6-2-8-25-14-19-18-12(20(14)10-4-5-10)9-11-3-1-7-24-11/h1,3,7,10H,2,4-6,8-9H2,(H3,16,17,21,22) |
| InChIKey | SVFRJQVPGRHNLN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|