C9H15N3OS — CID 100708912
2-(3-imidazol-1-ylpropylsulfanyl)-N-methylacetamide (PubChem CID 100708912) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropylsulfanyl)-N-methylacetamide.
| Compound Name | 2-(3-imidazol-1-ylpropylsulfanyl)-N-methylacetamide |
|---|---|
| PubChem CID | 100708912 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(3-imidazol-1-ylpropylsulfanyl)-N-methylacetamide |
| SMILES | CNC(=O)CSCCCn1ccnc1 |
| InChI | InChI=1S/C9H15N3OS/c1-10-9(13)7-14-6-2-4-12-5-3-11-8-12/h3,5,8H,2,4,6-7H2,1H3,(H,10,13) |
| InChIKey | CRFALHJRVFMAQS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|