C9H15N3O2S — CID 61493042
(2R)-2-amino-3-(3-imidazol-1-ylpropylsulfanyl)propanoic acid (PubChem CID 61493042) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is (2R)-2-amino-3-(3-imidazol-1-ylpropylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(3-imidazol-1-ylpropylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 61493042 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (2R)-2-amino-3-(3-imidazol-1-ylpropylsulfanyl)propanoic acid |
| SMILES | N[C@@H](CSCCCn1ccnc1)C(=O)O |
| InChI | InChI=1S/C9H15N3O2S/c10-8(9(13)14)6-15-5-1-3-12-4-2-11-7-12/h2,4,7-8H,1,3,5-6,10H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | UBUVDAPNVDNLAX-QMMMGPOBSA-N |
| XLogP | 0.42 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|