C8H13N3O2S — CID 61492079
2-amino-3-(2-pyrazol-1-ylethylsulfanyl)propanoic acid (PubChem CID 61492079) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-amino-3-(2-pyrazol-1-ylethylsulfanyl)propanoic acid.
| Compound Name | 2-amino-3-(2-pyrazol-1-ylethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 61492079 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-amino-3-(2-pyrazol-1-ylethylsulfanyl)propanoic acid |
| SMILES | NC(CSCCn1cccn1)C(=O)O |
| InChI | InChI=1S/C8H13N3O2S/c9-7(8(12)13)6-14-5-4-11-3-1-2-10-11/h1-3,7H,4-6,9H2,(H,12,13) |
| InChIKey | AVTDPGDUVSCTOP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|