C27H26N2O3 — CID 10071124
(3,5-dimethylphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate (PubChem CID 10071124) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate.
| Compound Name | (3,5-dimethylphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 10071124 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | (3,5-dimethylphenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
| SMILES | Cc1cc(C)cc(COC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C27H26N2O3/c1-18-12-19(2)14-20(13-18)17-32-27(31)25(29-26(30)21-8-4-3-5-9-21)15-22-16-28-24-11-7-6-10-23(22)24/h3-14,16,25,28H,15,17H2,1-2H3,(H,29,30)/t25-/m0/s1 |
| InChIKey | BKFSYSKVGGJRTB-VWLOTQADSA-N |
| XLogP | 4.87 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |