C19H19F2N3OS — CID 100711673
1-(3,4-difluorophenyl)-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]thiourea (PubChem CID 100711673) has the molecular formula C19H19F2N3OS and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]thiourea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100711673 |
| Molecular Formula | C19H19F2N3OS |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]thiourea |
| SMILES | O=C1CCCN1Cc1ccccc1CNC(=S)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F2N3OS/c20-16-8-7-15(10-17(16)21)23-19(26)22-11-13-4-1-2-5-14(13)12-24-9-3-6-18(24)25/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H2,22,23,26) |
| InChIKey | XUOCIKFYPNJVLO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|