About 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one
5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 10071236) has the molecular formula C26H21FN2O3
and a molecular weight of 428.46 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
Molecular Properties
| Compound Name | 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| PubChem CID | 10071236 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | CCOc1ccc(-c2c3c(c(O)c4ncccc24)C(=O)N(Cc2ccc(F)cc2)C3)cc1 |
| InChI | InChI=1S/C26H21FN2O3/c1-2-32-19-11-7-17(8-12-19)22-20-4-3-13-28-24(20)25(30)23-21(22)15-29(26(23)31)14-16-5-9-18(27)10-6-16/h3-13,30H,2,14-15H2,1H3 |
| InChIKey | SWIBQBSOVYGWFN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The IUPAC name of 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one (CID 10071236) is 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one.
What is the SMILES notation for 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The canonical SMILES for 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one is CCOc1ccc(-c2c3c(c(O)c4ncccc24)C(=O)N(Cc2ccc(F)cc2)C3)cc1.
What is the InChIKey of 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The InChIKey is SWIBQBSOVYGWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21FN2O3/c1-2-32-19-11-7-17(8-12-19)22-20-4-3-13-28-24(20)25(30)23-21(22)15-29(26(23)31)14-16-5-9-18(27)10-6-16/h3-13,30H,2,14-15H2,1H3.
What are the key properties of 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one?
5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one has a molecular weight of 428.46 g/mol, XLogP of 5.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-ethoxyphenyl)-7-[(4-fluorophenyl)methyl]-9-hydroxy-6H-pyrrolo[3,4-g]quinolin-8-one is sourced from PubChem (CID 10071236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).