C15H17N3O4 — CID 100713681
(2S)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)phenyl]oxolane-2-carboxamide (PubChem CID 100713681) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is (2S)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 100713681 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (2S)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2C(=O)CCNC2=O)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H17N3O4/c19-13-6-7-16-15(21)18(13)11-4-1-3-10(9-11)17-14(20)12-5-2-8-22-12/h1,3-4,9,12H,2,5-8H2,(H,16,21)(H,17,20)/t12-/m0/s1 |
| InChIKey | GYHNVSIKHSVEBE-LBPRGKRZSA-N |
| XLogP | 1.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |