C20H32N2O2SSi — CID 100714202
(1R)-2-[[2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-5-yl]methylamino]-1-phenylethanol (PubChem CID 100714202) has the molecular formula C20H32N2O2SSi and a molecular weight of 392.64 g/mol. Its IUPAC name is (1R)-2-[[2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-5-yl]methylamino]-1-phenylethanol.
| Compound Name | (1R)-2-[[2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-5-yl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 100714202 |
| Molecular Formula | C20H32N2O2SSi |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (1R)-2-[[2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-thiazol-5-yl]methylamino]-1-phenylethanol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)c1ncc(CNC[C@H](O)c2ccccc2)s1 |
| InChI | InChI=1S/C20H32N2O2SSi/c1-15(24-26(5,6)20(2,3)4)19-22-13-17(25-19)12-21-14-18(23)16-10-8-7-9-11-16/h7-11,13,15,18,21,23H,12,14H2,1-6H3/t15-,18+/m1/s1 |
| InChIKey | DVJZDTPLEUPPDF-QAPCUYQASA-N |
| XLogP | 5.05 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|