C16H19NO3S — CID 82886709
methyl 2-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]thiophen-2-yl]acetate (PubChem CID 82886709) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 2-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82886709 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | methyl 2-[5-[[(2-hydroxy-2-phenylethyl)amino]methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNCC(O)c2ccccc2)s1 |
| InChI | InChI=1S/C16H19NO3S/c1-20-16(19)9-13-7-8-14(21-13)10-17-11-15(18)12-5-3-2-4-6-12/h2-8,15,17-18H,9-11H2,1H3 |
| InChIKey | QKBNASSYVGVKHW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |