C15H16BrNO2S — CID 82894798
methyl 2-[5-[[(2-bromophenyl)methylamino]methyl]thiophen-2-yl]acetate (PubChem CID 82894798) has the molecular formula C15H16BrNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is methyl 2-[5-[[(2-bromophenyl)methylamino]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(2-bromophenyl)methylamino]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82894798 |
| Molecular Formula | C15H16BrNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | methyl 2-[5-[[(2-bromophenyl)methylamino]methyl]thiophen-2-yl]acetate |
| SMILES | COC(=O)Cc1ccc(CNCc2ccccc2Br)s1 |
| InChI | InChI=1S/C15H16BrNO2S/c1-19-15(18)8-12-6-7-13(20-12)10-17-9-11-4-2-3-5-14(11)16/h2-7,17H,8-10H2,1H3 |
| InChIKey | OPVUNNFLXOJIRK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |