C15H19NO2S2 — CID 82895050
methyl 2-[5-[[(3-ethylthiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetate (PubChem CID 82895050) has the molecular formula C15H19NO2S2 and a molecular weight of 309.46 g/mol. Its IUPAC name is methyl 2-[5-[[(3-ethylthiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[[(3-ethylthiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 82895050 |
| Molecular Formula | C15H19NO2S2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | methyl 2-[5-[[(3-ethylthiophen-2-yl)methylamino]methyl]thiophen-2-yl]acetate |
| SMILES | CCc1ccsc1CNCc1ccc(CC(=O)OC)s1 |
| InChI | InChI=1S/C15H19NO2S2/c1-3-11-6-7-19-14(11)10-16-9-13-5-4-12(20-13)8-15(17)18-2/h4-7,16H,3,8-10H2,1-2H3 |
| InChIKey | LRBVECXPVIDBGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |