C14H20N2O2S — CID 100714587
(1S,6R)-6-methyl-N-(3-methylphenyl)-1-oxo-1,4-thiazepane-4-carboxamide (PubChem CID 100714587) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is (1S,6R)-6-methyl-N-(3-methylphenyl)-1-oxo-1,4-thiazepane-4-carboxamide.
| Compound Name | (1S,6R)-6-methyl-N-(3-methylphenyl)-1-oxo-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 100714587 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (1S,6R)-6-methyl-N-(3-methylphenyl)-1-oxo-1,4-thiazepane-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2CC[S@@](=O)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C14H20N2O2S/c1-11-4-3-5-13(8-11)15-14(17)16-6-7-19(18)10-12(2)9-16/h3-5,8,12H,6-7,9-10H2,1-2H3,(H,15,17)/t12-,19-/m1/s1 |
| InChIKey | OVSWIDAKOCRCQN-CWTRNNRKSA-N |
| XLogP | 2.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |